DL-lysine

Structural formula

Business number 01G7
Molecular formula C6H14N2O2
Molecular weight 146.19
label

DL-2,6-diaminocaproic acid,

Tetracyanoethylene,

DL-lysine monohydrate

Numbering system

CAS number:70-54-2

MDL number:MFCD00064432

EINECS number:200-740-6

RTECS number:None

BRN number:1616991

PubChem number:24896317

Physical property data

1. Properties: colorless crystals

2. Density (g/mL, 25/4℃): 1.12

3. Relative vapor density (g/mL, Air=1): Uncertain

4. Melting point (ºC): 170 (dec.)(lit.)

5. Boiling point (ºC, normal pressure): Uncertain

6. Boiling point (ºC, 5.2kPa): Uncertain

7. Refractive index: Uncertain

8. Flash point (ºC): Uncertain

9. Specific rotation (º): Uncertain

10. Autoignition point or ignition temperature (ºC): Uncertain

11. Vapor pressure ( kPa, 25ºC): Uncertain

12. Saturated vapor pressure (kPa, 60ºC): Uncertain

13. Heat of combustion (KJ/mol): Uncertain

14. Critical temperature (ºC): Uncertain

15. Critical pressure (KPa): Uncertain

16. Oil-water (octanol/water) partition coefficient relationship Value: Uncertain

17. Explosion upper limit (%, V/V): Uncertain

18. Explosion lower limit (%, V/V): Uncertain

19. Solubility: soluble in water, slightly soluble in ethanol, insoluble in ether

Toxicological data

None

Ecological data

None

Molecular structure data

1. Molar refractive index: 38.43

2. Molar volume (cm3/mol): 129.9

3. Isotonic specific volume (90.2K ): 348.1

4. Surface tension (dyne/cm): 51.5

5. Polarizability (10-24cm3): 15.23

Compute chemical data

1. Reference value for hydrophobic parameter calculation (XlogP): None

2. Number of hydrogen bond donors: 3

3. Number of hydrogen bond acceptors: 4

4. Number of rotatable chemical bonds: 5

5. Number of tautomers: none

6. Topological molecule polar surface area 89.3

7. Number of heavy atoms: 10

8. Surface charge: 0

9. Complexity: 106

10. Number of isotope atoms: 0

11. Determine the number of atomic stereocenters: 0

12. Uncertain number of atomic stereocenters: 1

13. Determine the number of chemical bond stereocenters: 0

14. Number of uncertain chemical bond stereocenters: 0

15. Number of covalent bond units: 1

Properties and stability

None

Storage method

This product should be kept sealed, cool and dry.

Synthesis method

It can be extracted from the protein hydrolyzate produced by co-heating of protein and alkali or produced by organic synthesis using dihydropyran as raw material. The resulting product is DL-lysine. In fact, it is the same amount. A mixture of D-lysine molecules and L-lysine molecules are optical isomers of each other.

Purpose

Lysine is a key substance that helps other nutrients be fully absorbed and utilized by the human body. Only by supplementing enough L-lysine can the human body improve the absorption and utilization of food protein, achieve balanced nutrition, and promote growth and development.

extended-reading:https://www.bdmaee.net/niax-a-337-delayed-tertiary-amine-catalyst-momentive/
extended-reading:https://www.morpholine.org/category/morpholine/n-acetylmorpholine/
extended-reading:https://www.bdmaee.net/tin-tetrachloride-anhydrous/
extended-reading:https://www.bdmaee.net/tegoamin-bde-100/
extended-reading:https://www.newtopchem.com/archives/42953
extended-reading:https://www.bdmaee.net/niax-c-124-low-odor-tertiary-amine-catalyst-momentive/
extended-reading:https://www.newtopchem.com/archives/42995
extended-reading:https://www.cyclohexylamine.net/dabco-ne300-nnn-trimethyl-n-3-aminopropyl-bisaminoethyl-ether/
extended-reading:https://www.cyclohexylamine.net/category/product/page/7/
extended-reading:https://www.bdmaee.net/wp-content/uploads/2021/05/3-9.jpg

6-Methylmercaptopurine

6-Methylmercaptopurine structural formula

Structural formula

Business number 013Z
Molecular formula C6H6N4S
Molecular weight 166.2
label

6-Methylmercaptopurine,

6-(Methylthio)purine,

6-(methylthio)purine,

6-Methylmercaptopurine

Numbering system

CAS number:50-66-8

MDL number:MFCD00005576

EINECS number:200-057-3

RTECS number:UO8976000

BRN number:7695

PubChem ID:None

Physical property data

1. Properties: Uncertain

2. Density (g/mL, 25/4℃): Uncertain

3. Relative vapor density (g/mL, air =1): Uncertain

4. Melting point (ºC): 219-223 °C

5. Boiling point (ºC, normal pressure): Uncertain

6. Boiling point (ºC, 5.2 kPa): Uncertain

7. Refractive index: Uncertain

8. Flash point (ºC): Uncertain

9. Specific optical rotation (º): Uncertain

10. Autoignition point or ignition temperature (ºC): Uncertain

11. Vapor pressure (kPa, 25 ºC) : Uncertain

12. Saturated vapor pressure (kPa, 60 ºC): Uncertain

13. Heat of combustion (KJ/mol): Uncertain

14. Critical temperature (ºC): Uncertain

15. Critical pressure (KPa): Uncertain

16. Log value of oil-water (octanol/water) partition coefficient: Uncertain OK

17. Explosion upper limit (%, V/V): Uncertain

18. Explosion lower limit (%, V/V): Uncertain

19. Solubility: Uncertain

Toxicological data

1. Acute toxicity: mouse parenteral LD50: 115mg/kg; mouse LD10: 94mg/kg

Ecological data

None

Molecular structure data

1. Molar refractive index: 44.26

2. Molar volume (cm3/mol): 112.8

3. Isotonic specific volume (90.2K ): 348.9

4. Surface tension (dyne/cm): 91.4

5. Polarizability (10-24cm3): 17.54

Compute chemical data

1. Reference value for hydrophobic parameter calculation (XlogP): None

2. Number of hydrogen bond donors: 1

3. Number of hydrogen bond acceptors: 4

4. Number of rotatable chemical bonds: 1

5. Number of tautomers: 4

6. Topological molecule polar surface area 79.8

7. Number of heavy atoms: 11

8. Surface charge: 0

9. Complexity: 143

10. Number of isotope atoms: 0

11. Determined number of atomic stereocenters: 0

12. Uncertain number of atomic stereocenters: 0

13. Determine the number of stereocenters of chemical bonds: 0

14. Uncertain number of stereocenters of chemical bonds: 0

15. Number of covalent bond units: 1

Properties and stability

None

Storage method

None

Synthesis method

None

Purpose

None

extended-reading:https://www.newtopchem.com/archives/947
extended-reading:https://www.morpholine.org/3164-85-0-2/
extended-reading:https://www.bdmaee.net/wp-content/uploads/2022/08/124-1.jpg
extended-reading:https://www.cyclohexylamine.net/foaming-catalyst-foaming-catalyst-blx-11/
extended-reading:https://www.newtopchem.com/archives/44723
extended-reading:https://www.newtopchem.com/archives/44215
extended-reading:https://www.newtopchem.com/archives/738
extended-reading:https://www.newtopchem.com/archives/42767
extended-reading:https://www.newtopchem.com/archives/1811
extended-reading:https://www.bdmaee.net/wp-content/uploads/2022/08/-37-low-odor-polyurethane-rigid-foam-catalyst-polyurethane-rigid-foam-catalyst.pdf

Chloroquinine diphosphate

Chloroquinine diphosphate structural formula

Structural formula

Business number 013Y
Molecular formula C18H26N3Cl·2H3PO4
Molecular weight 515.86
label

7-Chloro-4-(4-diethylamino-1-methylbutylamino)quinoline diphosphate,

Quinoline chloride phosphate,

Chloroquine Phosphate,

Chloroquine diphosphate,

Chloroquine diphosphate,

(+/-)-Chloroquine Diphosphate,

(+/-)-Chloroquine Diphosphate Salt,

Chloroquine bis(phosphate),

1,4-Pentanediamine,N4-(7-chloro-4-quinolinyl)-N1,N1-diethyl-,phosphate (1:2),

N4-(7-Chloro-4-quinolinyl)-N1,N1

Numbering system

CAS number:50-63-5

MDL number:MFCD00069852

EINECS number:200-055-2

RTECS number:VB2450000

BRN number:4223142

PubChem number:24278090

Physical property data

1. Character:Colorless crystal. Bitter


2. Density (g/mL ,25/4): Undetermined


3. Relative vapor density (g /mL,AIR= 1): Undetermined


4. Melting point (ºC):193195(215218) .


5. Boiling point (ºC,Normal pressure): Undetermined


6. Boiling point ( ºC, 5.2 kPa): Undetermined


7. Refractive index:Undetermined


8. Flash point (ºC): Undetermined


9. Specific optical rotation (º ): Undetermined


10. Autoignition point or ignition temperature (ºC): Undetermined


11. Vapor pressure (kPa,25 ºC): Not OK


12. Saturated vapor pressure (kPa ,60 ºC): Undetermined


13. Heat of combustion (KJ/ mol): Undetermined


14. Critical temperature (ºC): Undetermined


15. Critical pressure (KPa): Undetermined


16. Oil and water (octanol/ Log value of partition coefficient for water: undetermined


17. Explosion limit (%, V/V): Undetermined


18. Lower explosion limit (%, V/V): Undetermined


19. Solubility:Easily soluble in water (1%Aqueous solutionpHapproximately4.5, less soluble when neutral or alkaline). Almost insoluble in ethanol, benzene, chloroform and ether.


Toxicological data

None

Ecological data

None

Molecular structure data

None

Compute chemical data

1. Reference value for hydrophobic parameter calculation (XlogP): None

2. Number of hydrogen bond donors: 7

3. Number of hydrogen bond acceptors: 11

4. Number of rotatable chemical bonds: 8

5. Number of tautomers: 3

6. Topological molecule polar surface area 184

7. Number of heavy atoms: 32

8. Surface charge: 0

9. Complexity: 359

10. Number of isotope atoms: 0

11. Determine the number of atomic stereocenters: 0

12. Uncertain number of atomic stereocenters: 1

13. Determine the number of chemical bond stereocenters: 0

14. Number of uncertain chemical bond stereocenters: 0

15. Number of covalent bond units: 3

Properties and stability

None

Storage method

This product is sealed and stored in a dry place away from light.

Synthesis method

4,7-Chloroquinoline and2-Amino -5Condensation of diethylaminopentane gives chloroquine .

Purpose



Used as an antimalarial drug.

extended-reading:https://www.newtopchem.com/archives/44163
extended-reading:https://www.newtopchem.com/archives/987
extended-reading:https://www.newtopchem.com/archives/45205
extended-reading:https://www.bdmaee.net/kaolizer-12p/
extended-reading:https://www.bdmaee.net/wp-content/uploads/2022/08/58.jpg
extended-reading:https://www.morpholine.org/polyurethane-catalyst-pc41/
extended-reading:https://www.bdmaee.net/wp-content/uploads/2022/08/FASCAT9201-catalyst-dibutyl-tin-oxide-FASCAT9201.pdf
extended-reading:https://www.bdmaee.net/cas-616-47-7/
extended-reading:https://www.newtopchem.com/archives/45056
extended-reading:https://www.newtopchem.com/archives/44169

DL-lysine hydrochloride

DL-lysine hydrochloride structural formula

Structural formula

Business number 01G6
Molecular formula C6H14N2O2
Molecular weight 182.65
label

DL-2,6-diaminocaproic acid hydrochloride,

DL-2,6-Diaminohexanoic acid monohydrochloride,

NH2(CH2)4CH(NH2)COOH · HCl,

amino acids,

pharmaceutical intermediates,

Amino acid salt

Numbering system

CAS number:70-53-1

MDL number:MFCD00064563

EINECS number:200-739-0

RTECS number:None

BRN number:4711993

PubChem number:24896425

Physical property data

1. Appearance: White crystalline powder

2. Density (g/mL, 25/4℃): Uncertain

3. Relative vapor density (g/mL, Air=1): Uncertain

4. Melting point (ºC): 260-2635. Boiling point (ºC, normal pressure): Uncertain

6. Boiling point (ºC, 5.2kPa): Uncertain

7. Refractive index: Uncertain

8. Flash point (ºC): Uncertain

9. Specific rotation (º): Uncertain

10. Autoignition point or ignition temperature (ºC): Uncertain

11. Vapor pressure (kPa, 25ºC): Uncertain

12. Saturated vapor pressure (kPa , 60ºC): Uncertain

13. Heat of combustion (KJ/mol): Uncertain

14. Critical temperature (ºC): Uncertain

15 . Critical pressure (KPa): Uncertain

16. Log value of oil-water (octanol/water) partition coefficient: Uncertain

17. Explosion upper limit (%, V/V ): Uncertain

18. Lower explosion limit (%, V/V): Uncertain

19. Solubility: soluble in water, slightly soluble in methanol, almost insoluble in benzene, Ether and chlorinated hydrocarbons.

Toxicological data

None

Ecological data

None

Molecular structure data

1. Molar refractive index: 38.43

2. Molar volume (cm3/mol): 129.9

3. Isotonic specific volume (90.2K ): 348.1

4. Surface tension (dyne/cm): 51.5

5. Polarizability (10-24cm3): 15.23

Compute chemical data

1. Reference value for hydrophobic parameter calculation (XlogP): None

2. Number of hydrogen bond donors: 4

3. Number of hydrogen bond acceptors: 4

4. Number of rotatable chemical bonds: 5

5. Number of tautomers: none

6. Topological molecule polar surface area 89.3

7. Number of heavy atoms: 11

8.Surface charge: 0

9. Complexity: 106

10. Number of isotope atoms: 0

11. Determine the number of atomic stereocenters: 0

12. Uncertain number of atomic stereocenters: 1

13. Determined number of chemical bond stereocenters: 0

14. Uncertain number of chemical bond stereocenters :0

15. Number of covalent bond units: 2

Properties and stability

None

Storage method

This product should be sealed, cool, dry and protected from light.

Synthesis method

None

Purpose

For biochemical research. ​​​

extended-reading:https://www.newtopchem.com/archives/561
extended-reading:https://www.newtopchem.com/archives/39742
extended-reading:https://www.bdmaee.net/zinc-neodecanoate-2/
extended-reading:https://www.bdmaee.net/fascat-4200/
extended-reading:https://www.cyclohexylamine.net/author/admin/
extended-reading:https://www.bdmaee.net/delayed-amine-catalyst-a-400/
extended-reading:https://www.newtopchem.com/archives/category/products/page/153
extended-reading:https://www.bdmaee.net/polycat-33-catalyst-cas10144-28-9-evonik-germany/
extended-reading:https://www.morpholine.org/cas-83016-70-0/
extended-reading:https://www.newtopchem.com/archives/category/products/page/46

Oxytocin

Oxytocin structural formula

Structural formula

Business number 013X
Molecular formula C43H66N12O12S2
Molecular weight 1007.2
label

N-Benzyloxycarbonyl-S-benzyl cysteinyl tyrosyl isoleucyl glutaminyl asparaginyl (S-benzyl) cysteinyl prolyl,

oxytocin,

A-Hypophamine,

Oxytocic hormone,

oxytocin

Numbering system

CAS number:50-56-6

MDL number:MFCD00076731

EINECS number:200-048-4

RTECS number:RS7534000

BRN number:3586108

PubChem number:24897975

Physical property data

1. Properties: White amorphous powder with slight odor 2. Density (g/mL, 25/4℃): Undetermined

3. Relative vapor density (g/mL, air=1): Undetermined

4. Melting point (ºC): 192-194°C

5. Boiling point (ºC, normal pressure): Undetermined

6. Boiling point (ºC , 5.2 kPa): Not determined

7. Refractive index: Not determined

8. Flash point (ºC): Not determined

9. Specific rotation (º): -26.2°, C=0.53, DIOXANE

10. Autoignition point or ignition temperature (ºC): Undetermined

11. Vapor pressure (kPa, 25 ºC ): Undetermined

12. Saturated vapor pressure (kPa, 60 ºC): Undetermined

13. Heat of combustion (KJ/mol): Undetermined

14. Critical temperature (ºC): Undetermined

15. Critical pressure (KPa): Undetermined

16. Log value of oil-water (octanol/water) partition coefficient: Undetermined

17. Explosion upper limit (%, V/V): Undetermined

18. Explosion lower limit (%, V/V): Undetermined

19. Solubility: Easily soluble in water, soluble in acetone, butanol and dilute acetic acid, insoluble in diethyl ether and petroleum ether

Toxicological data

None

Ecological data

None

Molecular structure data

None

Compute chemical data

1. Hydrophobic parameter calculation reference value (XlogP): -2.6

2. Number of hydrogen bond donors: 12

3. Number of hydrogen bond acceptors: 13

p>

4. Number of rotatable chemical bonds: 17

5. Number of tautomers: 1001

6. Topological molecular polar surface area (TPSA): 400

7. Number of heavy atoms: 69

8. Surface charge: 0

9. ���Hurility: 1870

10. Number of isotope atoms: 0

11. Number of determined atomic stereocenters: 9

12. Uncertain atomic stereocenter Number of stereocenters of chemical bonds: 0

13. Number of stereocenters of determined chemical bonds: 0

14. Number of stereocenters of uncertain chemical bonds: 0

15. Total Number of price key units: 1

Properties and stability

None

Storage method

Brown glass bottle with light-sealed packaging. Store in low temperature and dry place.

Synthesis method

1. Both oxytocin and vasopressin are nonapeptides. There is a basic amino acid residue in the vasopressin molecule, and their isoelectric points are different. The isoelectric point of oxytocin is 7.7 and that of vasopressin is 10.9, which means that vasopressin is highly alkaline. When the extract containing these two hormones is passed into an artificial zeolite column, vasopressin easily forms positively charged ions and most of them are adsorbed, while oxytocin flows out through the zeolite column. The effluent oxytocin solution can be treated with bentonite to obtain purer oxytocin.

Extraction of posterior pituitary gland dry powder ↓water separation ↓zeolite column to remove impurity protein ↓acetic acid

Bentonite adsorption ↓bentonite desorption ↓oxytocin acetate

The pituitary gland Add 100g of dry leaf powder and about 30g of quartz powder into 1.4L of distilled water, grind in a ball mill and extract for 45 minutes, centrifuge, and collect the supernatant. Add 1.4L, 1.3L, and 1.3L of water to the residue and extract 3 more times according to the above method. Combine the supernatants from 4 times of centrifugation. Add 1500g of the treated artificial zeolite to 20L of 0.25% acetic acid solution, stir and put it into the exchange column. When the 0.25% acetic acid solution in the exchange column drops to 2 to 3cm below the surface of the zeolite, immediately add the extraction solution and adjust the flow rate appropriately. , collect the white turbid liquid that begins to flow out of the adsorption column. When the liquid level of the extraction liquid drops to the surface of the zeolite, add distilled water immediately, and stop collecting when the turbid liquid flows out. The extract solution flowing through the zeolite was adjusted to pH=3.5 with glacial acetic acid, then rapidly heated to 95°C in a water bath for 3 minutes, cooled immediately, and placed in a cold room at 0 to 5°C overnight. Filter the next day to get a clear filtrate. Then, add the previously treated 10% bentonite slurry (usually 3ml per 100ml) to the filtrate while stirring, and stir continuously for 1 hour. The supernatant should be checked for complete adsorption (check with 20% sulfosalicylic acid solution, it should be No precipitation occurs), if the adsorption is incomplete, additional bentonite slurry should be added for adsorption. The 2 bentonite precipitations merged. The bentonite was then desorbed with 1% acetic acid solution. The total dosage is 5L and desorbed in 4 times. The dosages are 1.6L, 1.4L, 1.2L and 0.8L respectively. The 4 desorption liquids are combined. Determine the content of oxytocin and vasopressin in the desorption solution, and calculate the oxytocin potency. If the vasopressin does not exceed the limit, the oxytocin solution is obtained.

Purpose

1. It has a stimulating effect on smooth muscles and can cause the contraction of uterine smooth muscles, so it has an oxytocin effect. It can be used to induce labor, induce labor and uterine bleeding caused by weak uterine contractions after abortion. Intranasal instillation can promote milk excretion. It also has a slight hemostatic effect.

extended-reading:https://www.bdmaee.net/nn-dimethyl-ethanolamine/
extended-reading:https://www.cyclohexylamine.net/dabco-t-12-tin-catalyst-dabco-t-12-catalyst-t-12/
extended-reading:https://www.bdmaee.net/nt-cat-la-300-catalyst-cas10861-07-1-newtopchem/
extended-reading:https://www.morpholine.org/category/morpholine/page/2/
extended-reading:https://www.newtopchem.com/archives/44519
extended-reading:https://www.bdmaee.net/wp-content/uploads/2021/05/137-3.jpg
extended-reading:https://www.bdmaee.net/pc-cat-np40-catalyst-trisdimethylaminopropylhexahydrotriazine/
extended-reading:https://www.newtopchem.com/archives/954
extended-reading:https://www.bdmaee.net/butyl-tin-triisooctoate-cas23850-94-4-butyltin-tris/
extended-reading:https://www.bdmaee.net/reactive-composite-catalyst/

DL-mercaptosuccinic acid

DL-mercaptosuccinic acid structural formula

Structural formula

Business number 01G5
Molecular formula C4H6O4S
Molecular weight 150.15
label

Thiomalic acid,

thiomalic acid,

Mercaptosuccinic acid,

Thiosuccinic acid,

Thiomalic acid,

HOOCCH(SH)CH2COOH

Numbering system

CAS number:70-49-5

MDL number:MFCD00004860

EINECS number:200-736-4

RTECS number:WM8225000

BRN number:1099858

PubChem number:24889100

Physical property data

1. Properties: colorless crystals or white powder. There is an odor of sulfide

2. Density (g/mL, 25/4℃): Uncertain

3. Relative vapor density (g/mL, air=1): Uncertain

4. Melting point (ºC): 149-1505. Boiling point (ºC, normal pressure): Uncertain

6. Boiling point (ºC, 5.2kPa): Uncertain

7 .       Refractive index: Uncertain

8.       Flash point (ºC): Uncertain

9.       Specific rotation (º): Uncertain

10. Autoignition point or ignition temperature (ºC): Uncertain

11. Vapor pressure (kPa, 25ºC): Uncertain

12. Saturated vapor pressure (kPa, 60ºC): Uncertain Determine

13. Heat of combustion (KJ/mol): Uncertain

14. Critical temperature (ºC): Uncertain

15. Critical pressure (KPa ): Uncertain

16. Log value of oil-water (octanol/water) partition coefficient: Uncertain

17. Explosion upper limit (%, V/V): Uncertain

18. Lower explosion limit (%, V/V): Uncertain

19. Solubility: Easily soluble in water, alcohol, ether and acetone, almost insoluble in benzene

Toxicological data

Acute toxicity: mouse abdominal LD50: 200 mg/kg;

Ecological data

None

Molecular structure data

1. Molar refractive index: 31.56

2. Molar volume (cm3/mol): 98.2

3. Isotonic specific volume (90.2K ): 284.1

4. Surface tension (dyne/cm): 69.9

5. Polarizability (10-24cm3): 12.51

Compute chemical data

1. Reference value for hydrophobic parameter calculation (XlogP): -0.4

2. Number of hydrogen bond donors: 3

3. Number of hydrogen bond acceptors: 5

4. Number of rotatable chemical bonds: 3

5. Number of tautomers: none

6. Topological molecule polar surface area 75.6

7. Number of heavy atoms: 9

8. Surface charge: 0

9. Complexity: 133

10. Number of isotope atoms: 0

11. Determine the atomic stereocenter Quantity: 0

12. Uncertain number of atomic stereocenters: 1

13. Determined number of chemical bond stereocenters: 0

14. Uncertain chemical bonds Number of stereocenters: 0

15. Number of covalent bond units: 1

Properties and stability

None

Storage method

This product should be sealed, cool, dry and protected from light.

Synthesis method

Hydration of maleic anhydride produces maleic acid, which is then reacted with hydrogen sulfide to produce this product. For laboratory preparation, 23.2g malic acid and 20g thioacetic acid can be dissolved in 80ml ethyl acetate and refluxed for 1 hour. After cooling, add 400 ml of benzene to extract, add activated carbon for decolorization, filter to remove the carbon, and recover benzene to obtain crude product. After purification, 32g of acetylthiomalic acid was obtained, with a melting point of 126°C. Further hydrolysis yields mercaptosuccinic acid.

Purpose

This product is the main component of cold perm and is also used in complex concealment, biochemical research, heavy metal detoxifier and rubber industry.

extended-reading:https://www.newtopchem.com/archives/1029
extended-reading:https://www.morpholine.org/n-methylimidazole/
extended-reading:https://www.bdmaee.net/cas-27253-29-8/
extended-reading:https://www.newtopchem.com/archives/1095
extended-reading:https://www.bdmaee.net/niax-sa-800-tertiary-amine-catalyst-momentive/
extended-reading:https://www.bdmaee.net/nt-cat-k2097-catalyst-cas127-08-2-newtopchem/
extended-reading:https://www.newtopchem.com/archives/805
extended-reading:https://www.newtopchem.com/archives/39978
extended-reading:https://www.bdmaee.net/n-methylmorpholine/
extended-reading:https://www.cyclohexylamine.net/category/product/page/19/

L-(+)-anhydrous asparagine

L-(+)-anhydrous asparagine structural formula

Structural formula

Business number 01G4
Molecular formula C4H8N2O3
Molecular weight 132.12
label

biochemical reagents,

Intermediates

Numbering system

CAS number:70-47-3

MDL number:MFCD00064401

EINECS number:200-735-9

RTECS number:None

BRN number:1723527

PubChem number:24860328

Physical property data

1. Properties: white crystal. Odorless. Soluble in acid and alkali solutions, slightly soluble in water, almost insoluble in ethanol, ether, methanol and benzene.

2. Density (g/mL, 25/4℃): (d15/4) 1.404

3. Relative vapor density (g/mL, air=1): Not available Determined

4. Melting point (ºC): 234-235

5. Boiling point (ºC, normal pressure): Undetermined

6. Boiling point (ºC, normal pressure) 5.2kPa): Not determined

7. Refractive index: Not determined

8. Flash point (ºC): Not determined

9. Specific rotation ( º): [a] 20/D+20.0° (in 1mol/L hydrochloric acid), -9.3° (in 1mol/L sodium hydroxide).

10. Autoignition point or ignition temperature (ºC): Undetermined

11. Vapor pressure (kPa, 25ºC): Undetermined

12. Saturation Vapor pressure (kPa, 60ºC): Undetermined

13. Heat of combustion (KJ/mol): Undetermined

14. Critical temperature (ºC): Undetermined

15. Critical pressure (KPa): Undetermined

16. Log value of oil-water (octanol/water) partition coefficient: Undetermined

17. Explosion upper limit (% , V/V): Undetermined

18. Lower explosion limit (%, V/V): Undetermined

19. Solubility: Soluble in acid and alkali solutions, slightly soluble In water, almost insoluble in ethanol, ether, methanol and benzene.

Toxicological data

None

Ecological data

None

Molecular structure data

1. Molar refractive index: 29.20

2. Molar volume (cm3/mol): 94.0

3. Isotonic specific volume (90.2K ): 273.6

4. Surface tension (dyne/cm): 71.6

5. Polarizability (10-24cm3): 11.57

Compute chemical data

1. Hydrophobic parameter calculation reference value (XlogP): -3.4

2. Number of hydrogen bond donors: 3

3. Number of hydrogen bond acceptors: 4

p>

4. Number of rotatable chemical bonds: 3

5. Number of tautomers: 2

6. Topological molecular polar surface area (TPSA): 106

7. Number of heavy atoms: 9

8. Surface charge: 0

9. Complexity: 134

10. Isotopic elementNumber of subunits: 0

11. Determine the number of atomic stereocenters: 1

12. Uncertain number of atomic stereocenters: 0

13. Determine chemical bonds Number of stereocenters: 0

14, Number of uncertain chemical bond stereocenters: 0

15, Number of covalent bond units: 1

Properties and stability

1. Exists in flue-cured tobacco leaves, burley tobacco leaves and smoke.

Storage method

Stored sealed and protected from light.

Synthesis method

1. Aspartic acid is produced by acetylation.

2. Extracted from natural products.

Purpose

1. Microbial culture. Peptide synthesis. Test aminotransferase substrate. Tuberculosis culture. Preparation of biological culture media.

2.For the treatment of female breast lobular hyperplasia and gynecomastia.

3. It is used in microbial culture, sewage treatment, and raw materials for polypeptide synthesis. It is one of the components that constitute protein.

extended-reading:https://www.bdmaee.net/wp-content/uploads/2022/08/Potassium-neodecanoate-CAS26761-42-2-Neodecanoic-acid.pdf
extended-reading:https://www.cyclohexylamine.net/2-methylcyclohexylamine/
extended-reading:https://www.bdmaee.net/18-diazabicycloundec-7-ene-cas-6674-22-2-dbu/
extended-reading:https://www.morpholine.org/category/morpholine/page/5393/
extended-reading:https://www.bdmaee.net/teda-l25b-polyurethane-tertiary-amine-catalyst-tosoh/
extended-reading:https://www.cyclohexylamine.net/dabco-eg-pc-cat-td-33eg-niax-a-533/
extended-reading:https://www.bdmaee.net/sponge-catalyst-smp/
extended-reading:https://www.bdmaee.net/wp-content/uploads/2022/08/33.jpg
extended-reading:https://www.bdmaee.net/wp-content/uploads/2022/08/51.jpg
extended-reading:https://www.newtopchem.com/archives/1139

2,4-dinitro-1-fluorobenzene

2,4-dinitro-1-fluorobenzene structural formula

Structural formula

Business number 01G3
Molecular formula C6H3FN2O4
Molecular weight 186.1
label

2,4-dinitrofluorobenzene,

Sanger reagent,

1-Fluoro-2,4-dinitrobenzene,

dinitrofluorobenzene,

1-Fluoro-2-4-dinitrobenzene,

1,3-Dinitro-4-fluorobenzene,

Senger’s Reagent,

FNDP,

Aromatic nitrogen-containing compounds and their derivatives

Numbering system

CAS number:70-34-8

MDL number:MFCD00007056

EINECS number:200-734-3

RTECS number:CZ7800000

BRN number:398632

PubChem ID:None

Physical property data

1. Properties: Yellow needle-like crystals, which turn into orange-yellow liquid after liquefaction. [1]

2. Melting point (℃): 27.5~30[2]

3. Boiling point (℃) : 178 (3.33kPa); 296[3]

4. Relative density (water = 1): 1.48[4]

5. Saturated vapor pressure (kPa): 0.32×10-3 (25℃)[5]

6. Octanol/ Water partition coefficient: 1.83[6]

7. Flash point (℃): >110 (CC)[7]

8. Solubility: Soluble in ether, benzene, hot ethanol, and propylene glycol. [8]

Toxicological data

1. Acute toxicity:

Oral LCLo in mice: 50 mg/kg; LCLo administered onto the skin in mice: 100 mg/kg; LCLo injected subcutaneously in mice: 100 mg/kg;

2. Mutagenicity:

Salmonella microbial changes testing system: 5 ug/plate; Salmonella microbial changes testing system: 33 ug/plate; Bacteria-Escherichia coli microbiological changes test system: 5 umol/L;

3. Acute toxicity[9] LD50 : 50mg/kg (rat oral)

4. Irritation No information available

Ecological data

1. Ecotoxicity No data available

2. Biodegradability No data available

3 .Non-biodegradable[10] In the air, when the concentration of hydroxyl radicals is 5.00×105/cm3, the degradation half-life is 420d (theoretical).

4. Other harmful effects[11] This substance is harmful to the environment. Special attention should be paid to the pollution of water bodies. .

Molecular structure data

1. Molar refractive index: 39.33

2. Molar volume (cm3/mol): 117.3

3. Isotonic specific volume (90.2K ): 325.3

4. Surface tension (dyne/cm): 59.1

5. Polarizability (10-24cm3): 15.59

Scheduling��Chemical Data

1. Reference value for hydrophobic parameter calculation (XlogP): None

2. Number of hydrogen bond donors: 0

3. Number of hydrogen bond acceptors: 5

4. Number of rotatable chemical bonds: 0

5. Number of tautomers: none

6. Topological molecule polar surface area 91.6

7. Number of heavy atoms: 13

8. Surface charge: 0

9. Complexity: 224

10. Number of isotope atoms: 0

11. Determine the number of atomic stereocenters: 0

12. Uncertain number of atomic stereocenters: 0

13. Determine the number of chemical bond stereocenters: 0

14. Number of uncertain chemical bond stereocenters: 0

15. Number of covalent bond units: 1

Properties and stability

1. Stability[12] Stable

2. Incompatible substances[13] Strong oxidants, strong bases

3. Conditions to avoid contact[14] Heating

4. Polymerization hazard[15] No polymerization

5. Decomposition products[16] Nitrogen oxidation substance, hydrogen fluoride

Storage method

Storage Precautions[17] Storage in a cool, well-ventilated special warehouse, and implement the “two people to send and receive, two people to keep” system. Keep away from fire and heat sources. The packaging is sealed. They should be stored separately from oxidants, alkalis, and food chemicals, and avoid mixed storage. Equipped with the appropriate variety and quantity of fire equipment. Suitable materials should be available in the storage area to contain spills.

Synthesis method

1. Obtained from nucleophilic substitution reaction using 2,4-dinitrochlorobenzene and anhydrous potassium fluoride as raw materials.

2.Mix anhydrous potassium fluoride, dimethyl sulfoxide and an appropriate amount of polymerization inhibitor, control the heating to 120°C, and then add 2,4-dinitrochlorobenzene [reactants The ratio is 2,4-dinitrochlorobenzene: anhydrous potassium fluoride: dimethyl sulfoxide: polymerization inhibitor = 1.0: 1.8: 3.4: 0.1 (molar ratio)]. Maintain the reaction temperature at 110~120℃ (strictly control the reaction temperature to prevent explosion), react for 3 hours:

After the reaction, quickly cool to room temperature. Remove the potassium fluoride residue by suction filtration, add water to the filtrate and wash it, let it stand and separate the water layer (dimethyl sulfoxide can be recovered), wash the oil layer twice with water, distill under reduced pressure at 2.73kPa, collect 176~180℃ The distillate is the finished product 2,4-dinitrofluorobenzene.

Purpose

1. Used as a chromogenic reagent for the photometric determination of organic amines and neomycin. It is also used for the preparation of fluoride ion selective electrodes and the automatic flow injection dynamic potential method for the determination of paracetamol, isoniazid and phenoxypropylamine. Used as a chromatographic derivatization reagent for the determination of primary amines, secondary amines, alcohols, phenols, thiols, imidazole and carbonyl compounds.

2. Used as a reagent for protein analysis and a reducing agent for the determination of phenol, morphine, amino acids, aldehydes, and oximes. [18]

extended-reading:https://www.newtopchem.com/archives/40508
extended-reading:https://www.bdmaee.net/dibutyltin-diacetate-cas1067-33-0-dibutyl-tin-diacetate/
extended-reading:https://www.newtopchem.com/archives/44003
extended-reading:https://www.bdmaee.net/niax-a-310-balanced-tertiary-amine-catalyst-momentive/
extended-reading:https://www.bdmaee.net/high-quality-zinc-neodecanoate-cas-27253-29-8-neodecanoic-acid-zincsalt/
extended-reading:https://www.bdmaee.net/n-ethylmorpholine/
extended-reading:https://www.bdmaee.net/wp-content/uploads/2021/05/2-7.jpg
extended-reading:https://www.newtopchem.com/archives/45010
extended-reading:https://www.newtopchem.com/archives/567
extended-reading:https://www.bdmaee.net/low-odor-reaction-type-catalyst/

reserpine

Reserpine structural formula

Structural formula

Business number 013W
Molecular formula C33H40N2O9
Molecular weight 608.68
label

Lishepin,

Serpentine reserpine,

Heterogene,

serpentine,

Xue Anping,

adafen,

Anda blood level,

step down static,

Lisheping,

Pulse relaxes and falls,

Ruisuping; Nishoupin; Xueanping;

Numbering system

CAS number:50-55-5

MDL number:MFCD00005091

EINECS number:200-047-9

RTECS number:ZG0350000

BRN number:102014

PubChem number:24278208

Physical property data

1. Properties: Long prismatic crystals or white powder. Odorless. 2. Density (g/mL, 25/4℃): Undetermined

3. Relative vapor density (g/mL, air=1): Undetermined

4. Melting point (ºC): 264~2655 .       Boiling point (ºC, normal pressure): Not determined

6.      Boiling point (ºC, 5.2 kPa): Not determined

7.      Refractive index: 177 ° (C=1, DMF)

8. Flash point (ºC): Undetermined

9. Specific rotation (º): -118° (chloroform), -164° (c=0.96, pyridine)

p>

10. Autoignition point or ignition temperature (ºC): Undetermined

11. Vapor pressure (kPa, 25 ºC): Undetermined

12. Saturated vapor Pressure (kPa, 60 ºC): Undetermined

13. Heat of combustion (KJ/mol): Undetermined

14. Critical temperature (ºC): Undetermined

15. Critical pressure (KPa): Undetermined

16. Log value of oil-water (octanol/water) partition coefficient: Undetermined

17. Explosion upper limit (% , V/V): Undetermined

18. Lower explosion limit (%, V/V): Undetermined

19. Solubility: Easily soluble in chloroform (about 1g/6ml ), tetrachloromethane, glacial acetic acid, soluble in benzene, ethyl acetate, slightly soluble in acetone, methanol, ethanol (1g/1800ml), ether, acetic acid solution and citric acid solution, very slightly soluble in water.

Toxicological data

None

Ecological data

None

Molecular structure data

1. Molar refractive index: 160.93

2. Molar volume (cm3/mol): 458.1

3. Isotonic specific volume(90.2K): 1274.4

4. Surface tension (dyne/cm): 59.8

5. Polarizability (10-24cm3): 63.80

Compute chemical data

1. Reference value for hydrophobic parameter calculation (XlogP): 4

2. Number of hydrogen bond donors: 1

3. Number of hydrogen bond acceptors: 10

4. Number of rotatable chemical bonds: 10

5. Number of tautomers: none

6. Topological molecule polar surface area 118

7. Number of heavy atoms: 44

8. Surface charge: 0

9. Complexity: 1000

10. Number of isotope atoms: 0

11. Determine the number of atomic stereocenters: 6

12. Uncertain number of atomic stereocenters: 0

13. Determine the number of chemical bond stereocenters: 0

14. Number of uncertain chemical bond stereocenters: 0

15. Number of covalent bond units: 1

Properties and stability

None

Storage method

This product should be sealed and stored in a dry place away from light.

Synthesis method

This strain is an alkaloid extracted from the gum that precipitates when the all-alkali plant (Rauwolfia genus) of the Apocynaceae family (Rauwolfia) is concentrated in the acid permeate solution, and is produced by chemical synthesis. However, there is currently no synthetic method to produce value, and they are all extracted from Rauwolfia rauwolfia. Take the colloidal substance that precipitates when the acidic percolation liquid of Rauwolfia vulgaris is evaporated and concentrated, add ethanol and glacial acetic acid to obtain an acidic ethanol solution, and then extract it with chloroform to obtain a chloroform solution. It is extracted with acetone in a sexual solution and refined to obtain reserpine. Since this product is highly susceptible to oxidation and deterioration, the entire production process must be conducted away from light. The total yield is about 0.01% for crude drugs and about 0.5% for colloids.

Purpose

Biochemical research. Medicine (antihypertensive drugs)

extended-reading:https://www.newtopchem.com/archives/595
extended-reading:https://www.newtopchem.com/archives/820
extended-reading:https://www.newtopchem.com/archives/922
extended-reading:https://www.bdmaee.net/wp-content/uploads/2022/08/FASCAT4210-catalyst-CAS-683-18-1-dibutyltin-dichloride.pdf
extended-reading:https://www.newtopchem.com/archives/category/products/page/165
extended-reading:https://www.bdmaee.net/dabco-xd-102-catalyst-cas106317-60-3-evonik-germany/
extended-reading:https://www.bdmaee.net/wp-content/uploads/2022/08/Bismuth-Isooctanoate-CAS67874-71-9-2-ethylhexanoic-acid-bismuth.pdf
extended-reading:https://www.bdmaee.net/fascat-4102/
extended-reading:https://www.bdmaee.net/dibutyl-tin-dilaurate/
extended-reading:http://kkkchem.com

1-Methyl-3-nitro-1-guanidine nitrite

1-methyl-3-nitro-1-guanidine nitrite structural formula

Structural formula

Business number 01G2
Molecular formula C2H5N5O3
Molecular weight 147.09
label

N-methyl-N’-nitro-N-nitrosoguanidine,

Diazomethane precursor,

MNNG,

N-Methyl-N′-nitro-N-nitrosoguanidine,

CH3N(NO)C(=NH)NHNO2

Numbering system

CAS number:70-25-7

MDL number:MFCD00007034

EINECS number:200-730-1

RTECS number:MF4200000

BRN number:1779490

PubChem number:24845846

Physical property data

1. Properties: yellow crystal.

2. Density (g/mL, 25/4℃): Undetermined

3. Relative vapor density (g/mL, air=1): Undetermined

4. Melting point (ºC): 118℃ (decomposition)

5. Boiling point (ºC, normal pressure): Undetermined

6. Boiling point (ºC, 5.2kPa ): Not determined

7. Refractive index: Not determined

8. Flash point (ºC): Not determined

9. Specific rotation (º) : Undetermined

10. Autoignition point or ignition temperature (ºC): Undetermined

11. Vapor pressure (kPa, 25ºC): Undetermined

12. Saturated vapor pressure (kPa, 60ºC): Undetermined

13. Heat of combustion (KJ/mol): Undetermined

14. Critical temperature (ºC): Undetermined

15. Critical pressure (KPa): Undetermined

16. Log value of oil-water (octanol/water) partition coefficient: Undetermined

17. Explosion Upper limit (%, V/V): Undetermined

18. Lower explosion limit (%, V/V): Undetermined

19. Solubility: Soluble in water.

Toxicological data

None

Ecological data

None

Molecular structure data

1. Molar refractive index: 30.06

2. Molar volume (cm3/mol): 83.3

3. Isotonic specific volume (90.2K ): 255.9

4. Surface tension (dyne/cm): 88.8

5. Polarizability (10-24cm3): 11.91

Compute chemical data

1. Reference value for hydrophobic parameter calculation (XlogP): -0.2

2. Number of hydrogen bond donors: 1

3. Number of hydrogen bond acceptors: 5

4. Number of rotatable chemical bonds: 1

5. Number of tautomers: 2

6. Topological molecule polar surface area 117

7. Number of heavy atoms: 10

8. Surface charge: 0

9. Complexity: 170

10. Number of isotope atoms: 0

11. Determine the number of stereocenters of atoms: 0

12. Determine the number of stereocenters of atoms: 0

13. Determine the number of stereocenters of chemical bonds: 1

14. Number of uncertain chemical bond stereocenters: 0

15. Number of covalent bond units: 1

Properties and stability

None

Storage method

This product should be sealed and stored at 0℃ to avoid light. It can gradually decompose after long-term storage, and may cause an explosion when it decomposes to a certain pressure. Commercially available products often contain 50% water-wetting products.

Synthesis method

None

Purpose

Chemical mutagens and cancer research. ​

extended-reading:https://www.newtopchem.com/archives/39983
extended-reading:https://www.bdmaee.net/wp-content/uploads/2022/08/22-1.jpg
extended-reading:https://www.cyclohexylamine.net/cas-3855-32-1-2610-trimethyl-2610-triazaundacane/
extended-reading:https://www.newtopchem.com/archives/44998
extended-reading:https://www.newtopchem.com/archives/45044
extended-reading:https://www.newtopchem.com/archives/category/products/page/43
extended-reading:https://www.cyclohexylamine.net/amine-catalyst-smp-delayed-catalyst-smp/
extended-reading:https://www.cyclohexylamine.net/dabco-8154-2-ethylhexanoic-acid-solution-of-triethylenediamine/
extended-reading:https://www.newtopchem.com/archives/category/products/page/80
extended-reading:https://www.bdmaee.net/dabco-dc5le-reaction-type-delayed-catalyst-reaction-type-catalyst/